C12H15BrN4O4 — CID 114439586
3-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-1-methylpyrrolidine-2,5-dione (PubChem CID 114439586) has the molecular formula C12H15BrN4O4 and a molecular weight of 359.18 g/mol. Its IUPAC name is 3-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 114439586 |
| Molecular Formula | C12H15BrN4O4 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]-1-methylpyrrolidine-2,5-dione |
| SMILES | COCCn1ncc(NC2CC(=O)N(C)C2=O)c(Br)c1=O |
| InChI | InChI=1S/C12H15BrN4O4/c1-16-9(18)5-7(11(16)19)15-8-6-14-17(3-4-21-2)12(20)10(8)13/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | QSAICUONNYPTQF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|