C29H30FN5O4 — CID 11443971
N-[[(5S)-3-[4-[4-[6-(3-cyanophenyl)hex-5-ynoyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 11443971) has the molecular formula C29H30FN5O4 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-[6-(3-cyanophenyl)hex-5-ynoyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[4-[6-(3-cyanophenyl)hex-5-ynoyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11443971 |
| Molecular Formula | C29H30FN5O4 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-[[(5S)-3-[4-[4-[6-(3-cyanophenyl)hex-5-ynoyl]piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)CCCC#Cc4cccc(C#N)c4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C29H30FN5O4/c1-21(36)32-19-25-20-35(29(38)39-25)24-10-11-27(26(30)17-24)33-12-14-34(15-13-33)28(37)9-4-2-3-6-22-7-5-8-23(16-22)18-31/h5,7-8,10-11,16-17,25H,2,4,9,12-15,19-20H2,1H3,(H,32,36)/t25-/m0/s1 |
| InChIKey | VUXMUFRJNOTTKP-VWLOTQADSA-N |
| XLogP | 3.03 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|