C14H22ClN3O2 — CID 114439792
4-chloro-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114439792) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 4-chloro-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114439792 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-chloro-5-[(2-hydroxy-2,4-dimethylpentyl)amino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCC(C)(O)CC(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C14H22ClN3O2/c1-5-6-18-13(19)12(15)11(8-17-18)16-9-14(4,20)7-10(2)3/h5,8,10,16,20H,1,6-7,9H2,2-4H3 |
| InChIKey | KAHXFIUVHKGPOA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|