C31H52O5Si — CID 11443986
(5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-6,7-dimethyl-2-methylidene-5-tri(propan-2-yl)silyloxyocta-3,7-dienyl]oxiran-2-yl]-4-hydroxy-5-methyl-6-methylideneoxocan-2-one (PubChem CID 11443986) has the molecular formula C31H52O5Si and a molecular weight of 532.84 g/mol. Its IUPAC name is (5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-6,7-dimethyl-2-methylidene-5-tri(propan-2-yl)silyloxyocta-3,7-dienyl]oxiran-2-yl]-4-hydroxy-5-methyl-6-methylideneoxocan-2-one.
| Compound Name | (5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-6,7-dimethyl-2-methylidene-5-tri(propan-2-yl)silyloxyocta-3,7-dienyl]oxiran-2-yl]-4-hydroxy-5-methyl-6-methylideneoxocan-2-one |
|---|---|
| PubChem CID | 11443986 |
| Molecular Formula | C31H52O5Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | (5S,8R)-8-[(2S,3R)-3-[(3E,5R,6S)-6,7-dimethyl-2-methylidene-5-tri(propan-2-yl)silyloxyocta-3,7-dienyl]oxiran-2-yl]-4-hydroxy-5-methyl-6-methylideneoxocan-2-one |
| SMILES | C=C(/C=C/[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=C)C)C[C@H]1O[C@@H]1[C@H]1CC(=C)[C@H](C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C31H52O5Si/c1-18(2)24(11)27(36-37(19(3)4,20(5)6)21(7)8)14-13-22(9)15-28-31(35-28)29-16-23(10)25(12)26(32)17-30(33)34-29/h13-14,19-21,24-29,31-32H,1,9-10,15-17H2,2-8,11-12H3/b14-13+/t24-,25-,26?,27+,28+,29+,31-/m0/s1 |
| InChIKey | NISPUAFKZCKDTC-GJXOMOCXSA-N |
| XLogP | 7.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|