About 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one
4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one (PubChem CID 114440772) has the molecular formula C9H10ClF2N3O
and a molecular weight of 249.65 g/mol. Its IUPAC name is 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one |
| PubChem CID | 114440772 |
| Molecular Formula | C9H10ClF2N3O |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCC(F)F)c(Cl)c1=O |
| InChI | InChI=1S/C9H10ClF2N3O/c1-2-3-15-9(16)8(10)6(4-14-15)13-5-7(11)12/h2,4,7,13H,1,3,5H2 |
| InChIKey | LLMGKCJSLPMMFB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one?
The IUPAC name of 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one (CID 114440772) is 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one.
What is the SMILES notation for 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one?
The canonical SMILES for 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one is C=CCn1ncc(NCC(F)F)c(Cl)c1=O.
What is the InChIKey of 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one?
The InChIKey is LLMGKCJSLPMMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF2N3O/c1-2-3-15-9(16)8(10)6(4-14-15)13-5-7(11)12/h2,4,7,13H,1,3,5H2.
What are the key properties of 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one?
4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one has a molecular weight of 249.65 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(2,2-difluoroethylamino)-2-prop-2-enylpyridazin-3-one is sourced from PubChem (CID 114440772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).