C14H20BrN3O3 — CID 114441836
4-bromo-2-(cyclopropylmethyl)-5-[(3-methoxyoxolan-3-yl)methylamino]pyridazin-3-one (PubChem CID 114441836) has the molecular formula C14H20BrN3O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is 4-bromo-2-(cyclopropylmethyl)-5-[(3-methoxyoxolan-3-yl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(cyclopropylmethyl)-5-[(3-methoxyoxolan-3-yl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114441836 |
| Molecular Formula | C14H20BrN3O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-bromo-2-(cyclopropylmethyl)-5-[(3-methoxyoxolan-3-yl)methylamino]pyridazin-3-one |
| SMILES | COC1(CNc2cnn(CC3CC3)c(=O)c2Br)CCOC1 |
| InChI | InChI=1S/C14H20BrN3O3/c1-20-14(4-5-21-9-14)8-16-11-6-17-18(7-10-2-3-10)13(19)12(11)15/h6,10,16H,2-5,7-9H2,1H3 |
| InChIKey | NSJUSCLWPIHHEI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |