C30H44O5S2 — CID 11444205
S-tert-butyl (2S)-2-[(1S,2S)-2-methyl-3-oxo-2-(3-oxo-4-phenylsulfanylbutyl)cyclopentyl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate (PubChem CID 11444205) has the molecular formula C30H44O5S2 and a molecular weight of 548.81 g/mol. Its IUPAC name is S-tert-butyl (2S)-2-[(1S,2S)-2-methyl-3-oxo-2-(3-oxo-4-phenylsulfanylbutyl)cyclopentyl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate.
| Compound Name | S-tert-butyl (2S)-2-[(1S,2S)-2-methyl-3-oxo-2-(3-oxo-4-phenylsulfanylbutyl)cyclopentyl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate |
|---|---|
| PubChem CID | 11444205 |
| Molecular Formula | C30H44O5S2 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | S-tert-butyl (2S)-2-[(1S,2S)-2-methyl-3-oxo-2-(3-oxo-4-phenylsulfanylbutyl)cyclopentyl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate |
| SMILES | CC1(C)O[C@@H](C[C@H](C(=O)SC(C)(C)C)[C@@H]2CCC(=O)[C@@]2(C)CCC(=O)CSc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C30H44O5S2/c1-27(2,3)37-26(33)22(18-25-28(4,5)35-29(6,7)34-25)23-14-15-24(32)30(23,8)17-16-20(31)19-36-21-12-10-9-11-13-21/h9-13,22-23,25H,14-19H2,1-8H3/t22-,23-,25-,30-/m0/s1 |
| InChIKey | OXVRAWPRUANWHV-RNIXSPGKSA-N |
| XLogP | 7.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|