C14H20BrN3O — CID 114442063
5-bromo-2-(cyclobutylmethyl)-4-[(3-methylcyclobutyl)amino]pyridazin-3-one (PubChem CID 114442063) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 5-bromo-2-(cyclobutylmethyl)-4-[(3-methylcyclobutyl)amino]pyridazin-3-one.
| Compound Name | 5-bromo-2-(cyclobutylmethyl)-4-[(3-methylcyclobutyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114442063 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-bromo-2-(cyclobutylmethyl)-4-[(3-methylcyclobutyl)amino]pyridazin-3-one |
| SMILES | CC1CC(Nc2c(Br)cnn(CC3CCC3)c2=O)C1 |
| InChI | InChI=1S/C14H20BrN3O/c1-9-5-11(6-9)17-13-12(15)7-16-18(14(13)19)8-10-3-2-4-10/h7,9-11,17H,2-6,8H2,1H3 |
| InChIKey | JTVRHTVUVWYWOS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |