C27H35NO11 — CID 11444214
(5S,8S,9R)-8-benzoyl-2-[(Z,1S,2S)-1,2-bis(methoxymethoxy)hex-3-enyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 11444214) has the molecular formula C27H35NO11 and a molecular weight of 549.57 g/mol. Its IUPAC name is (5S,8S,9R)-8-benzoyl-2-[(Z,1S,2S)-1,2-bis(methoxymethoxy)hex-3-enyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8S,9R)-8-benzoyl-2-[(Z,1S,2S)-1,2-bis(methoxymethoxy)hex-3-enyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 11444214 |
| Molecular Formula | C27H35NO11 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | (5S,8S,9R)-8-benzoyl-2-[(Z,1S,2S)-1,2-bis(methoxymethoxy)hex-3-enyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC/C=C\[C@H](OCOC)[C@H](OCOC)C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](O)(C(=O)c1ccccc1)[C@@H]2OCOC |
| InChI | InChI=1S/C27H35NO11/c1-6-7-13-19(36-14-33-3)21(37-15-34-4)20-17(2)22(29)26(39-20)24(38-16-35-5)27(32,28-25(26)31)23(30)18-11-9-8-10-12-18/h7-13,19,21,24,32H,6,14-16H2,1-5H3,(H,28,31)/b13-7-/t19-,21-,24+,26+,27+/m0/s1 |
| InChIKey | RWQBHOMAXYSIPC-ZVNRWZPSSA-N |
| XLogP | 1.23 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|