C10H14BrN3O2 — CID 114442459
4-bromo-2-methyl-5-[(3-methyloxolan-3-yl)amino]pyridazin-3-one (PubChem CID 114442459) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[(3-methyloxolan-3-yl)amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[(3-methyloxolan-3-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114442459 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-bromo-2-methyl-5-[(3-methyloxolan-3-yl)amino]pyridazin-3-one |
| SMILES | Cn1ncc(NC2(C)CCOC2)c(Br)c1=O |
| InChI | InChI=1S/C10H14BrN3O2/c1-10(3-4-16-6-10)13-7-5-12-14(2)9(15)8(7)11/h5,13H,3-4,6H2,1-2H3 |
| InChIKey | CKTDJMZHVSZSLK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |