C25H47NO3SiSn — CID 11444308
[(1S,8S)-3-oxo-7-[tributylstannyl(trimethylsilyl)methyl]-1,2,5,8-tetrahydropyrrolizin-1-yl] acetate (PubChem CID 11444308) has the molecular formula C25H47NO3SiSn and a molecular weight of 556.45 g/mol. Its IUPAC name is [(1S,8S)-3-oxo-7-[tributylstannyl(trimethylsilyl)methyl]-1,2,5,8-tetrahydropyrrolizin-1-yl] acetate.
| Compound Name | [(1S,8S)-3-oxo-7-[tributylstannyl(trimethylsilyl)methyl]-1,2,5,8-tetrahydropyrrolizin-1-yl] acetate |
|---|---|
| PubChem CID | 11444308 |
| Molecular Formula | C25H47NO3SiSn |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | [(1S,8S)-3-oxo-7-[tributylstannyl(trimethylsilyl)methyl]-1,2,5,8-tetrahydropyrrolizin-1-yl] acetate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(C1=CCN2C(=O)C[C@H](OC(C)=O)[C@H]12)[Si](C)(C)C |
| InChI | InChI=1S/C13H20NO3Si.3C4H9.Sn/c1-9(15)17-11-7-12(16)14-6-5-10(13(11)14)8-18(2,3)4;3*1-3-4-2;/h5,8,11,13H,6-7H2,1-4H3;3*1,3-4H2,2H3;/t11-,13-;;;;/m0..../s1 |
| InChIKey | VDJNTHZNLBQXOC-VICLKIPVSA-N |
| XLogP | 6.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|