C14H23BrN4O — CID 114443681
4-bromo-2-ethyl-5-[4-[1-(methylamino)ethyl]piperidin-1-yl]pyridazin-3-one (PubChem CID 114443681) has the molecular formula C14H23BrN4O and a molecular weight of 343.27 g/mol. Its IUPAC name is 4-bromo-2-ethyl-5-[4-[1-(methylamino)ethyl]piperidin-1-yl]pyridazin-3-one.
| Compound Name | 4-bromo-2-ethyl-5-[4-[1-(methylamino)ethyl]piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 114443681 |
| Molecular Formula | C14H23BrN4O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-bromo-2-ethyl-5-[4-[1-(methylamino)ethyl]piperidin-1-yl]pyridazin-3-one |
| SMILES | CCn1ncc(N2CCC(C(C)NC)CC2)c(Br)c1=O |
| InChI | InChI=1S/C14H23BrN4O/c1-4-19-14(20)13(15)12(9-17-19)18-7-5-11(6-8-18)10(2)16-3/h9-11,16H,4-8H2,1-3H3 |
| InChIKey | NFXXFQSUEJFOGB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |