C13H21BrN4O — CID 114444121
4-bromo-2-(cyclopropylmethyl)-5-[3-(ethylamino)propylamino]pyridazin-3-one (PubChem CID 114444121) has the molecular formula C13H21BrN4O and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-bromo-2-(cyclopropylmethyl)-5-[3-(ethylamino)propylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(cyclopropylmethyl)-5-[3-(ethylamino)propylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114444121 |
| Molecular Formula | C13H21BrN4O |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-bromo-2-(cyclopropylmethyl)-5-[3-(ethylamino)propylamino]pyridazin-3-one |
| SMILES | CCNCCCNc1cnn(CC2CC2)c(=O)c1Br |
| InChI | InChI=1S/C13H21BrN4O/c1-2-15-6-3-7-16-11-8-17-18(9-10-4-5-10)13(19)12(11)14/h8,10,15-16H,2-7,9H2,1H3 |
| InChIKey | LLBSCMORIBCSHT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|