C33H45NO7 — CID 11444469
[(2R,3S,4R,5R)-5-acetamido-3,4-bis(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methyl octanoate (PubChem CID 11444469) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-acetamido-3,4-bis(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methyl octanoate.
| Compound Name | [(2R,3S,4R,5R)-5-acetamido-3,4-bis(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 11444469 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | [(2R,3S,4R,5R)-5-acetamido-3,4-bis(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methyl octanoate |
| SMILES | C=CCOC1O[C@H](COC(=O)CCCCCCC)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C33H45NO7/c1-4-6-7-8-15-20-29(36)38-24-28-31(39-22-26-16-11-9-12-17-26)32(40-23-27-18-13-10-14-19-27)30(34-25(3)35)33(41-28)37-21-5-2/h5,9-14,16-19,28,30-33H,2,4,6-8,15,20-24H2,1,3H3,(H,34,35)/t28-,30-,31-,32-,33?/m1/s1 |
| InChIKey | XKPMWTILEZIXIP-DCIOQESFSA-N |
| XLogP | 5.49 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|