C33H39N3O6 — CID 11444535
5-tert-butyl-N-cyclopropyl-2-methoxy-3-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]benzamide (PubChem CID 11444535) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is 5-tert-butyl-N-cyclopropyl-2-methoxy-3-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]benzamide.
| Compound Name | 5-tert-butyl-N-cyclopropyl-2-methoxy-3-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]benzamide |
|---|---|
| PubChem CID | 11444535 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 5-tert-butyl-N-cyclopropyl-2-methoxy-3-[[2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetyl]amino]benzamide |
| SMILES | COc1c(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c3ccccc23)cc(C(C)(C)C)cc1C(=O)NC1CC1 |
| InChI | InChI=1S/C33H39N3O6/c1-33(2,3)21-19-26(31(38)34-22-9-10-22)30(40-4)27(20-21)35-32(39)29(37)25-11-12-28(24-8-6-5-7-23(24)25)42-18-15-36-13-16-41-17-14-36/h5-8,11-12,19-20,22H,9-10,13-18H2,1-4H3,(H,34,38)(H,35,39) |
| InChIKey | GCBLXOYMYLHGMF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|