C24H41Cl3O7Si — CID 11444554
(3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid (PubChem CID 11444554) has the molecular formula C24H41Cl3O7Si and a molecular weight of 576.03 g/mol. Its IUPAC name is (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid.
| Compound Name | (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid |
|---|---|
| PubChem CID | 11444554 |
| Molecular Formula | C24H41Cl3O7Si |
| Molecular Weight | 576.03 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid |
| SMILES | C=CC[C@H](C)[C@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H41Cl3O7Si/c1-9-13-16(5)20(33-22(31)32-15-24(25,26)27)17(6)21(30)23(7,8)18(14-19(28)29)34-35(10-2,11-3)12-4/h9,16-18,20H,1,10-15H2,2-8H3,(H,28,29)/t16-,17+,18-,20-/m0/s1 |
| InChIKey | AZLIEIIHTBDSGL-DMUMMCEESA-N |
| XLogP | 7.19 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.03 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|