C15H21ClN4O — CID 114446178
4-chloro-5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-prop-2-enylpyridazin-3-one (PubChem CID 114446178) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-chloro-5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-chloro-5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114446178 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-chloro-5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(N2CC3CNCC3C2CC)c(Cl)c1=O |
| InChI | InChI=1S/C15H21ClN4O/c1-3-5-20-15(21)14(16)13(8-18-20)19-9-10-6-17-7-11(10)12(19)4-2/h3,8,10-12,17H,1,4-7,9H2,2H3 |
| InChIKey | CWKIJNSRPIITKT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|