C18H15N7S — CID 11444688
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(1H-imidazol-5-yl)ethylamino]pyrimidin-4-yl]acetonitrile (PubChem CID 11444688) has the molecular formula C18H15N7S and a molecular weight of 361.43 g/mol. Its IUPAC name is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(1H-imidazol-5-yl)ethylamino]pyrimidin-4-yl]acetonitrile.
| Compound Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(1H-imidazol-5-yl)ethylamino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 11444688 |
| Molecular Formula | C18H15N7S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(1H-imidazol-5-yl)ethylamino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1/Nc2ccccc2S1)c1ccnc(NCCc2cnc[nH]2)n1 |
| InChI | InChI=1S/C18H15N7S/c19-9-13(17-24-15-3-1-2-4-16(15)26-17)14-6-8-22-18(25-14)21-7-5-12-10-20-11-23-12/h1-4,6,8,10-11,24H,5,7H2,(H,20,23)(H,21,22,25)/b17-13+ |
| InChIKey | QOEAHTBZGUOMCB-GHRIWEEISA-N |
| XLogP | 3.26 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|