C11H14F3N5S — CID 114448088
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114448088) has the molecular formula C11H14F3N5S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114448088 |
| Molecular Formula | C11H14F3N5S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cc(C)n(CCCNc2nnc(C(F)(F)F)s2)n1 |
| InChI | InChI=1S/C11H14F3N5S/c1-7-6-8(2)19(18-7)5-3-4-15-10-17-16-9(20-10)11(12,13)14/h6H,3-5H2,1-2H3,(H,15,17) |
| InChIKey | YNHFLLXCYGUGKH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|