C7H11N5O — CID 114448156
2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]acetamide (PubChem CID 114448156) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]acetamide.
| Compound Name | 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 114448156 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]acetamide |
| SMILES | Cc1nnc(NCC(N)=O)nc1C |
| InChI | InChI=1S/C7H11N5O/c1-4-5(2)11-12-7(10-4)9-3-6(8)13/h3H2,1-2H3,(H2,8,13)(H,9,10,12) |
| InChIKey | ZVHABYKDWQAQQA-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |