About N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine
N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114448235) has the molecular formula C10H14F3N3S
and a molecular weight of 265.30 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 114448235 |
| Molecular Formula | C10H14F3N3S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC1CCCC(Nc2nnc(C(F)(F)F)s2)C1 |
| InChI | InChI=1S/C10H14F3N3S/c1-6-3-2-4-7(5-6)14-9-16-15-8(17-9)10(11,12)13/h6-7H,2-5H2,1H3,(H,14,16) |
| InChIKey | JWXNZBJBCVAHCB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (CID 114448235) is N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine is CC1CCCC(Nc2nnc(C(F)(F)F)s2)C1.
What is the InChIKey of N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is JWXNZBJBCVAHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3S/c1-6-3-2-4-7(5-6)14-9-16-15-8(17-9)10(11,12)13/h6-7H,2-5H2,1H3,(H,14,16).
What are the key properties of N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine?
N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 265.30 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylcyclohexyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 114448235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).