C33H60O4SSi2 — CID 11444869
[(1R,3aR,4S,7aR)-1-[(2R)-1-(benzenesulfonyl)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11444869) has the molecular formula C33H60O4SSi2 and a molecular weight of 609.08 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2R)-1-(benzenesulfonyl)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2R)-1-(benzenesulfonyl)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11444869 |
| Molecular Formula | C33H60O4SSi2 |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2R)-1-(benzenesulfonyl)-6-methyl-6-trimethylsilyloxyheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(CCC[C@@H](CS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)O[Si](C)(C)C |
| InChI | InChI=1S/C33H60O4SSi2/c1-31(2,3)40(10,11)36-30-20-16-24-33(6)28(21-22-29(30)33)26(17-15-23-32(4,5)37-39(7,8)9)25-38(34,35)27-18-13-12-14-19-27/h12-14,18-19,26,28-30H,15-17,20-25H2,1-11H3/t26-,28+,29-,30-,33+/m0/s1 |
| InChIKey | JIXAYOIAYLBRFR-WHHOGAPLSA-N |
| XLogP | 9.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|