About 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole
2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole (PubChem CID 114449595) has the molecular formula C9H4F3IN2OS
and a molecular weight of 372.11 g/mol. Its IUPAC name is 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole |
| PubChem CID | 114449595 |
| Molecular Formula | C9H4F3IN2OS |
| Molecular Weight | 372.11 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole |
| SMILES | FC(F)(F)c1nnc(Oc2cccc(I)c2)s1 |
| InChI | InChI=1S/C9H4F3IN2OS/c10-9(11,12)7-14-15-8(17-7)16-6-3-1-2-5(13)4-6/h1-4H |
| InChIKey | ZFMPEXDRNFYXTQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.11 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole?
The IUPAC name of 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole (CID 114449595) is 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole is FC(F)(F)c1nnc(Oc2cccc(I)c2)s1.
What is the InChIKey of 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole?
The InChIKey is ZFMPEXDRNFYXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3IN2OS/c10-9(11,12)7-14-15-8(17-7)16-6-3-1-2-5(13)4-6/h1-4H.
What are the key properties of 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole?
2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole has a molecular weight of 372.11 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-iodophenoxy)-5-(trifluoromethyl)-1,3,4-thiadiazole is sourced from PubChem (CID 114449595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).