C46H42N2 — CID 11444975
N-[(Z)-2-(benzhydrylideneamino)-1,2-bis(2,4,6-trimethylphenyl)ethenyl]-1,1-diphenylmethanimine (PubChem CID 11444975) has the molecular formula C46H42N2 and a molecular weight of 622.86 g/mol. Its IUPAC name is N-[(Z)-2-(benzhydrylideneamino)-1,2-bis(2,4,6-trimethylphenyl)ethenyl]-1,1-diphenylmethanimine.
| Compound Name | N-[(Z)-2-(benzhydrylideneamino)-1,2-bis(2,4,6-trimethylphenyl)ethenyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11444975 |
| Molecular Formula | C46H42N2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | N-[(Z)-2-(benzhydrylideneamino)-1,2-bis(2,4,6-trimethylphenyl)ethenyl]-1,1-diphenylmethanimine |
| SMILES | Cc1cc(C)c(/C(N=C(c2ccccc2)c2ccccc2)=C(/N=C(c2ccccc2)c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C46H42N2/c1-31-27-33(3)41(34(4)28-31)45(47-43(37-19-11-7-12-20-37)38-21-13-8-14-22-38)46(42-35(5)29-32(2)30-36(42)6)48-44(39-23-15-9-16-24-39)40-25-17-10-18-26-40/h7-30H,1-6H3/b46-45- |
| InChIKey | YKGBUYJWEXBVAN-KZXRXFMCSA-N |
| XLogP | 11.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|