About 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole
2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole (PubChem CID 114450038) has the molecular formula C6H2BrF3N4S
and a molecular weight of 299.08 g/mol. Its IUPAC name is 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole |
| PubChem CID | 114450038 |
| Molecular Formula | C6H2BrF3N4S |
| Molecular Weight | 299.08 g/mol |
| Exact Mass | 297.91 |
| IUPAC Name | 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole |
| SMILES | FC(F)(F)c1nnc(-n2cc(Br)cn2)s1 |
| InChI | InChI=1S/C6H2BrF3N4S/c7-3-1-11-14(2-3)5-13-12-4(15-5)6(8,9)10/h1-2H |
| InChIKey | TYHFHTOVOVSHCA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.08 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole?
The IUPAC name of 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole (CID 114450038) is 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole is FC(F)(F)c1nnc(-n2cc(Br)cn2)s1.
What is the InChIKey of 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole?
The InChIKey is TYHFHTOVOVSHCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrF3N4S/c7-3-1-11-14(2-3)5-13-12-4(15-5)6(8,9)10/h1-2H.
What are the key properties of 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole?
2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole has a molecular weight of 299.08 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromopyrazol-1-yl)-5-(trifluoromethyl)-1,3,4-thiadiazole is sourced from PubChem (CID 114450038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).