C6H3F3N6S2 — CID 114450247
1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-1,2,4-triazole-3-carbothioamide (PubChem CID 114450247) has the molecular formula C6H3F3N6S2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 114450247 |
| Molecular Formula | C6H3F3N6S2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 1-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(-c2nnc(C(F)(F)F)s2)n1 |
| InChI | InChI=1S/C6H3F3N6S2/c7-6(8,9)4-12-13-5(17-4)15-1-11-3(14-15)2(10)16/h1H,(H2,10,16) |
| InChIKey | WOMPTMMPEGWJFD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|