C26H23O5PW — CID 11445025
carbon monoxide;(1S,8R)-4,10-dimethyl-11-phenyl-7-propan-2-yl-11-phosphatricyclo[6.2.1.01,5]undeca-2,4,6,9-tetraene;tungsten (PubChem CID 11445025) has the molecular formula C26H23O5PW and a molecular weight of 630.28 g/mol. Its IUPAC name is carbon monoxide;(1S,8R)-4,10-dimethyl-11-phenyl-7-propan-2-yl-11-phosphatricyclo[6.2.1.01,5]undeca-2,4,6,9-tetraene;tungsten.
| Compound Name | carbon monoxide;(1S,8R)-4,10-dimethyl-11-phenyl-7-propan-2-yl-11-phosphatricyclo[6.2.1.01,5]undeca-2,4,6,9-tetraene;tungsten |
|---|---|
| PubChem CID | 11445025 |
| Molecular Formula | C26H23O5PW |
| Molecular Weight | 630.28 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | carbon monoxide;(1S,8R)-4,10-dimethyl-11-phenyl-7-propan-2-yl-11-phosphatricyclo[6.2.1.01,5]undeca-2,4,6,9-tetraene;tungsten |
| SMILES | CC1=C[C@@H]2C(C(C)C)=CC3=C(C)C=C[C@]13P2c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C21H23P.5CO.W/c1-14(2)18-13-19-15(3)10-11-21(19)16(4)12-20(18)22(21)17-8-6-5-7-9-17;5*1-2;/h5-14,20H,1-4H3;;;;;;/t20-,21+,22?;;;;;;/m1....../s1 |
| InChIKey | TWORIHISEDSQOG-LOWMAGNMSA-N |
| XLogP | 5.15 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|