C8H11ClF3N3S — CID 114450341
N-(3-chloro-2,2-dimethylpropyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114450341) has the molecular formula C8H11ClF3N3S and a molecular weight of 273.71 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114450341 |
| Molecular Formula | C8H11ClF3N3S |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)(CCl)CNc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H11ClF3N3S/c1-7(2,3-9)4-13-6-15-14-5(16-6)8(10,11)12/h3-4H2,1-2H3,(H,13,15) |
| InChIKey | XDWTZUDPVCXXRJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|