C13H20N2O4 — CID 114450847
methyl 4-[2-(2-cyanoethylamino)-2-oxoethoxy]cyclohexane-1-carboxylate (PubChem CID 114450847) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 4-[2-(2-cyanoethylamino)-2-oxoethoxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[2-(2-cyanoethylamino)-2-oxoethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 114450847 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | methyl 4-[2-(2-cyanoethylamino)-2-oxoethoxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OCC(=O)NCCC#N)CC1 |
| InChI | InChI=1S/C13H20N2O4/c1-18-13(17)10-3-5-11(6-4-10)19-9-12(16)15-8-2-7-14/h10-11H,2-6,8-9H2,1H3,(H,15,16) |
| InChIKey | FLHWODLUIFFUMJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|