C14H16ClNO5 — CID 114450930
4-[(2-chloro-4-nitrophenyl)methoxy]cyclohexane-1-carboxylic acid (PubChem CID 114450930) has the molecular formula C14H16ClNO5 and a molecular weight of 313.74 g/mol. Its IUPAC name is 4-[(2-chloro-4-nitrophenyl)methoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-chloro-4-nitrophenyl)methoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114450930 |
| Molecular Formula | C14H16ClNO5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[(2-chloro-4-nitrophenyl)methoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(OCc2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C14H16ClNO5/c15-13-7-11(16(19)20)4-1-10(13)8-21-12-5-2-9(3-6-12)14(17)18/h1,4,7,9,12H,2-3,5-6,8H2,(H,17,18) |
| InChIKey | AXZOGUMRXBWJST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|