C23H15F17O2 — CID 11445143
[(1S)-1-naphthalen-2-ylethyl] 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate (PubChem CID 11445143) has the molecular formula C23H15F17O2 and a molecular weight of 646.34 g/mol. Its IUPAC name is [(1S)-1-naphthalen-2-ylethyl] 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate.
| Compound Name | [(1S)-1-naphthalen-2-ylethyl] 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |
|---|---|
| PubChem CID | 11445143 |
| Molecular Formula | C23H15F17O2 |
| Molecular Weight | 646.34 g/mol |
| Exact Mass | 646.08 |
| IUPAC Name | [(1S)-1-naphthalen-2-ylethyl] 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |
| SMILES | C[C@H](OC(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H15F17O2/c1-11(13-7-6-12-4-2-3-5-14(12)10-13)42-15(41)8-9-16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)21(34,35)22(36,37)23(38,39)40/h2-7,10-11H,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | KNPZOEYYMGZUJV-NSHDSACASA-N |
| XLogP | 9.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.34 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|