C14H13ClFNO2S — CID 114452507
3-[(3-chloro-5-fluorophenyl)methylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 114452507) has the molecular formula C14H13ClFNO2S and a molecular weight of 313.78 g/mol. Its IUPAC name is 3-[(3-chloro-5-fluorophenyl)methylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(3-chloro-5-fluorophenyl)methylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 114452507 |
| Molecular Formula | C14H13ClFNO2S |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-[(3-chloro-5-fluorophenyl)methylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NCc1cc(F)cc(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C14H13ClFNO2S/c15-10-4-9(5-11(16)6-10)8-17-12(7-14(18)19)13-2-1-3-20-13/h1-6,12,17H,7-8H2,(H,18,19) |
| InChIKey | DYKZCHVDPPDLLV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |