C16H18ClFN2O — CID 114453365
1-(3-chloro-5-fluorophenyl)-N-(4-methoxyphenyl)-N-methylethane-1,2-diamine (PubChem CID 114453365) has the molecular formula C16H18ClFN2O and a molecular weight of 308.78 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-N-(4-methoxyphenyl)-N-methylethane-1,2-diamine.
| Compound Name | 1-(3-chloro-5-fluorophenyl)-N-(4-methoxyphenyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 114453365 |
| Molecular Formula | C16H18ClFN2O |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-N-(4-methoxyphenyl)-N-methylethane-1,2-diamine |
| SMILES | COc1ccc(N(C)C(CN)c2cc(F)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H18ClFN2O/c1-20(14-3-5-15(21-2)6-4-14)16(10-19)11-7-12(17)9-13(18)8-11/h3-9,16H,10,19H2,1-2H3 |
| InChIKey | YBWWPCJJJNDUHZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|