C34H18Br2F6 — CID 11445435
2-(bromomethyl)-1-[2-(bromomethyl)-3-(3,4,5-trifluorophenyl)naphthalen-1-yl]-3-(3,4,5-trifluorophenyl)naphthalene (PubChem CID 11445435) has the molecular formula C34H18Br2F6 and a molecular weight of 700.31 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[2-(bromomethyl)-3-(3,4,5-trifluorophenyl)naphthalen-1-yl]-3-(3,4,5-trifluorophenyl)naphthalene.
| Compound Name | 2-(bromomethyl)-1-[2-(bromomethyl)-3-(3,4,5-trifluorophenyl)naphthalen-1-yl]-3-(3,4,5-trifluorophenyl)naphthalene |
|---|---|
| PubChem CID | 11445435 |
| Molecular Formula | C34H18Br2F6 |
| Molecular Weight | 700.31 g/mol |
| Exact Mass | 697.97 |
| IUPAC Name | 2-(bromomethyl)-1-[2-(bromomethyl)-3-(3,4,5-trifluorophenyl)naphthalen-1-yl]-3-(3,4,5-trifluorophenyl)naphthalene |
| SMILES | Fc1cc(-c2cc3ccccc3c(-c3c(CBr)c(-c4cc(F)c(F)c(F)c4)cc4ccccc34)c2CBr)cc(F)c1F |
| InChI | InChI=1S/C34H18Br2F6/c35-15-25-23(19-11-27(37)33(41)28(38)12-19)9-17-5-1-3-7-21(17)31(25)32-22-8-4-2-6-18(22)10-24(26(32)16-36)20-13-29(39)34(42)30(40)14-20/h1-14H,15-16H2 |
| InChIKey | BVAMBWKGQOVWNB-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.31 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|