C15H14ClFIN3 — CID 114454627
2-(3-chloro-5-fluorophenyl)-6-cyclopentyl-5-iodopyrimidin-4-amine (PubChem CID 114454627) has the molecular formula C15H14ClFIN3 and a molecular weight of 417.65 g/mol. Its IUPAC name is 2-(3-chloro-5-fluorophenyl)-6-cyclopentyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(3-chloro-5-fluorophenyl)-6-cyclopentyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 114454627 |
| Molecular Formula | C15H14ClFIN3 |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 2-(3-chloro-5-fluorophenyl)-6-cyclopentyl-5-iodopyrimidin-4-amine |
| SMILES | Nc1nc(-c2cc(F)cc(Cl)c2)nc(C2CCCC2)c1I |
| InChI | InChI=1S/C15H14ClFIN3/c16-10-5-9(6-11(17)7-10)15-20-13(8-3-1-2-4-8)12(18)14(19)21-15/h5-8H,1-4H2,(H2,19,20,21) |
| InChIKey | ITUDVYSWEKWETE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|