C15H20ClFN2O — CID 114454804
6-amino-7-(3-chloro-5-fluorophenyl)-1-propan-2-ylazepan-2-one (PubChem CID 114454804) has the molecular formula C15H20ClFN2O and a molecular weight of 298.79 g/mol. Its IUPAC name is 6-amino-7-(3-chloro-5-fluorophenyl)-1-propan-2-ylazepan-2-one.
| Compound Name | 6-amino-7-(3-chloro-5-fluorophenyl)-1-propan-2-ylazepan-2-one |
|---|---|
| PubChem CID | 114454804 |
| Molecular Formula | C15H20ClFN2O |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 6-amino-7-(3-chloro-5-fluorophenyl)-1-propan-2-ylazepan-2-one |
| SMILES | CC(C)N1C(=O)CCCC(N)C1c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C15H20ClFN2O/c1-9(2)19-14(20)5-3-4-13(18)15(19)10-6-11(16)8-12(17)7-10/h6-9,13,15H,3-5,18H2,1-2H3 |
| InChIKey | ZXEMDXZJCHRZNZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |