C16H19ClFNO — CID 114455022
1-[(3-chloro-5-fluorophenyl)-hydroxymethyl]-3-ethylcyclohexane-1-carbonitrile (PubChem CID 114455022) has the molecular formula C16H19ClFNO and a molecular weight of 295.78 g/mol. Its IUPAC name is 1-[(3-chloro-5-fluorophenyl)-hydroxymethyl]-3-ethylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(3-chloro-5-fluorophenyl)-hydroxymethyl]-3-ethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 114455022 |
| Molecular Formula | C16H19ClFNO |
| Molecular Weight | 295.78 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[(3-chloro-5-fluorophenyl)-hydroxymethyl]-3-ethylcyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(C(O)c2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C16H19ClFNO/c1-2-11-4-3-5-16(9-11,10-19)15(20)12-6-13(17)8-14(18)7-12/h6-8,11,15,20H,2-5,9H2,1H3 |
| InChIKey | VDXPTOMEKHUGBX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |