C15H17ClFNO2 — CID 114455061
4-(3-chloro-5-fluorophenyl)-3-(2-methylpropyl)piperidine-2,6-dione (PubChem CID 114455061) has the molecular formula C15H17ClFNO2 and a molecular weight of 297.76 g/mol. Its IUPAC name is 4-(3-chloro-5-fluorophenyl)-3-(2-methylpropyl)piperidine-2,6-dione.
| Compound Name | 4-(3-chloro-5-fluorophenyl)-3-(2-methylpropyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 114455061 |
| Molecular Formula | C15H17ClFNO2 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-(3-chloro-5-fluorophenyl)-3-(2-methylpropyl)piperidine-2,6-dione |
| SMILES | CC(C)CC1C(=O)NC(=O)CC1c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C15H17ClFNO2/c1-8(2)3-13-12(7-14(19)18-15(13)20)9-4-10(16)6-11(17)5-9/h4-6,8,12-13H,3,7H2,1-2H3,(H,18,19,20) |
| InChIKey | YYPYUGVOCIHCSW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|