C29H20N6O9S4 — CID 11445520
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioylamino]benzoic acid (PubChem CID 11445520) has the molecular formula C29H20N6O9S4 and a molecular weight of 724.78 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 11445520 |
| Molecular Formula | C29H20N6O9S4 |
| Molecular Weight | 724.78 g/mol |
| Exact Mass | 724.02 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioylamino]benzoic acid |
| SMILES | NS(=O)(=O)c1nnc(NS(=O)(=O)c2ccc(NC(=S)Nc3ccc(-c4c5ccc(=O)cc-5oc5cc(O)ccc45)c(C(=O)O)c3)cc2)s1 |
| InChI | InChI=1S/C29H20N6O9S4/c30-47(40,41)29-34-33-28(46-29)35-48(42,43)18-6-1-14(2-7-18)31-27(45)32-15-3-8-19(22(11-15)26(38)39)25-20-9-4-16(36)12-23(20)44-24-13-17(37)5-10-21(24)25/h1-13,36H,(H,33,35)(H,38,39)(H2,30,40,41)(H2,31,32,45) |
| InChIKey | BSPIBNAXTIUUSM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 243.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|