C13H13N5O2 — CID 114455346
2-[(2-aminophenoxy)methyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 114455346) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[(2-aminophenoxy)methyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-[(2-aminophenoxy)methyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 114455346 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[(2-aminophenoxy)methyl]-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(COc3ccccc3N)nc2n1 |
| InChI | InChI=1S/C13H13N5O2/c1-8-6-12(19)18-13(15-8)16-11(17-18)7-20-10-5-3-2-4-9(10)14/h2-6H,7,14H2,1H3,(H,15,16,17) |
| InChIKey | ZNTRKQPUBLVNDL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|