C11H16N2O4S2 — CID 114456040
1-(2-methylsulfonylethylsulfonyl)-2,3-dihydroindol-7-amine (PubChem CID 114456040) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylsulfonyl)-2,3-dihydroindol-7-amine.
| Compound Name | 1-(2-methylsulfonylethylsulfonyl)-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456040 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(2-methylsulfonylethylsulfonyl)-2,3-dihydroindol-7-amine |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N1CCc2cccc(N)c21 |
| InChI | InChI=1S/C11H16N2O4S2/c1-18(14,15)7-8-19(16,17)13-6-5-9-3-2-4-10(12)11(9)13/h2-4H,5-8,12H2,1H3 |
| InChIKey | QJDWPIJIKYCJJQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|