C15H20N4 — CID 114456381
1-[(3-propylimidazol-4-yl)methyl]-2,3-dihydroindol-7-amine (PubChem CID 114456381) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[(3-propylimidazol-4-yl)methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[(3-propylimidazol-4-yl)methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456381 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-[(3-propylimidazol-4-yl)methyl]-2,3-dihydroindol-7-amine |
| SMILES | CCCn1cncc1CN1CCc2cccc(N)c21 |
| InChI | InChI=1S/C15H20N4/c1-2-7-19-11-17-9-13(19)10-18-8-6-12-4-3-5-14(16)15(12)18/h3-5,9,11H,2,6-8,10,16H2,1H3 |
| InChIKey | MFDNAAGDSCWGQQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|