C16H20F2O — CID 114458081
1-cycloheptyl-3-(2,4-difluorophenyl)propan-2-one (PubChem CID 114458081) has the molecular formula C16H20F2O and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,4-difluorophenyl)propan-2-one.
| Compound Name | 1-cycloheptyl-3-(2,4-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 114458081 |
| Molecular Formula | C16H20F2O |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-cycloheptyl-3-(2,4-difluorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(F)cc1F)CC1CCCCCC1 |
| InChI | InChI=1S/C16H20F2O/c17-14-8-7-13(16(18)11-14)10-15(19)9-12-5-3-1-2-4-6-12/h7-8,11-12H,1-6,9-10H2 |
| InChIKey | RUFKMRSQBJZECG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |