C17H21BrN2O — CID 114458197
4-(2-bromophenyl)-3-(cycloheptylmethyl)-1,2-oxazol-5-amine (PubChem CID 114458197) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is 4-(2-bromophenyl)-3-(cycloheptylmethyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(2-bromophenyl)-3-(cycloheptylmethyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 114458197 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-(2-bromophenyl)-3-(cycloheptylmethyl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(CC2CCCCCC2)c1-c1ccccc1Br |
| InChI | InChI=1S/C17H21BrN2O/c18-14-10-6-5-9-13(14)16-15(20-21-17(16)19)11-12-7-3-1-2-4-8-12/h5-6,9-10,12H,1-4,7-8,11,19H2 |
| InChIKey | BXKAVVXYPQOITO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |