About (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate (PubChem CID 114458340) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate.
Molecular Properties
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate |
| PubChem CID | 114458340 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)CC1CCCCCC1)C2 |
| InChI | InChI=1S/C19H32O2/c1-18(2)15-10-11-19(18,3)16(13-15)21-17(20)12-14-8-6-4-5-7-9-14/h14-16H,4-13H2,1-3H3 |
| InChIKey | HJQUNCKRILRRAV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate?
The IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate (CID 114458340) is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate.
What is the SMILES notation for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate?
The canonical SMILES for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate is CC1(C)C2CCC1(C)C(OC(=O)CC1CCCCCC1)C2.
What is the InChIKey of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate?
The InChIKey is HJQUNCKRILRRAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O2/c1-18(2)15-10-11-19(18,3)16(13-15)21-17(20)12-14-8-6-4-5-7-9-14/h14-16H,4-13H2,1-3H3.
What are the key properties of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate?
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate has a molecular weight of 292.46 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-cycloheptylacetate is sourced from PubChem (CID 114458340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).