C17H25BrO — CID 114458981
[2-bromo-3-(3-methoxyphenyl)propyl]cycloheptane (PubChem CID 114458981) has the molecular formula C17H25BrO and a molecular weight of 325.29 g/mol. Its IUPAC name is [2-bromo-3-(3-methoxyphenyl)propyl]cycloheptane.
| Compound Name | [2-bromo-3-(3-methoxyphenyl)propyl]cycloheptane |
|---|---|
| PubChem CID | 114458981 |
| Molecular Formula | C17H25BrO |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-bromo-3-(3-methoxyphenyl)propyl]cycloheptane |
| SMILES | COc1cccc(CC(Br)CC2CCCCCC2)c1 |
| InChI | InChI=1S/C17H25BrO/c1-19-17-10-6-9-15(13-17)12-16(18)11-14-7-4-2-3-5-8-14/h6,9-10,13-14,16H,2-5,7-8,11-12H2,1H3 |
| InChIKey | VVSBUCAFDWGTFX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|