C18H32N2O — CID 114459250
N-[3-[5-(cycloheptylmethyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine (PubChem CID 114459250) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[3-[5-(cycloheptylmethyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-[5-(cycloheptylmethyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114459250 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[3-[5-(cycloheptylmethyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCCc1ncc(CC2CCCCCC2)o1 |
| InChI | InChI=1S/C18H32N2O/c1-18(2,3)20-12-8-11-17-19-14-16(21-17)13-15-9-6-4-5-7-10-15/h14-15,20H,4-13H2,1-3H3 |
| InChIKey | GUOOVLVTNWKWEH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|