C15H25NO3 — CID 114459612
2-(2,2-diethoxyethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol (PubChem CID 114459612) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol.
| Compound Name | 2-(2,2-diethoxyethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 114459612 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol |
| SMILES | CCOC(Cn1cc2c(c1)C(O)CCCC2)OCC |
| InChI | InChI=1S/C15H25NO3/c1-3-18-15(19-4-2)11-16-9-12-7-5-6-8-14(17)13(12)10-16/h9-10,14-15,17H,3-8,11H2,1-2H3 |
| InChIKey | IZHPFVVFMPTBLF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|