C16H21FN2O — CID 114459701
(5-amino-2-fluorophenyl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114459701) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is (5-amino-2-fluorophenyl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (5-amino-2-fluorophenyl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114459701 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (5-amino-2-fluorophenyl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC(C)(C)C1=CCN(C(=O)c2cc(N)ccc2F)CC1 |
| InChI | InChI=1S/C16H21FN2O/c1-16(2,3)11-6-8-19(9-7-11)15(20)13-10-12(18)4-5-14(13)17/h4-6,10H,7-9,18H2,1-3H3 |
| InChIKey | OCJVYDUHRWGZRD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|