C12H18N4O2 — CID 114459992
(4-amino-1,2,5-oxadiazol-3-yl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114459992) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (4-amino-1,2,5-oxadiazol-3-yl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (4-amino-1,2,5-oxadiazol-3-yl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114459992 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (4-amino-1,2,5-oxadiazol-3-yl)-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC(C)(C)C1=CCN(C(=O)c2nonc2N)CC1 |
| InChI | InChI=1S/C12H18N4O2/c1-12(2,3)8-4-6-16(7-5-8)11(17)9-10(13)15-18-14-9/h4H,5-7H2,1-3H3,(H2,13,15) |
| InChIKey | UKSRNFMVZVLKAJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|